C11H22BNO3 — CID 143049678
[1-(2-ethylpentanoyl)pyrrolidin-2-yl]boronic acid (PubChem CID 143049678) has the molecular formula C11H22BNO3 and a molecular weight of 227.11 g/mol. Its IUPAC name is [1-(2-ethylpentanoyl)pyrrolidin-2-yl]boronic acid.
| Compound Name | [1-(2-ethylpentanoyl)pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 143049678 |
| Molecular Formula | C11H22BNO3 |
| Molecular Weight | 227.11 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | [1-(2-ethylpentanoyl)pyrrolidin-2-yl]boronic acid |
| SMILES | CCCC(CC)C(=O)N1CCCC1B(O)O |
| InChI | InChI=1S/C11H22BNO3/c1-3-6-9(4-2)11(14)13-8-5-7-10(13)12(15)16/h9-10,15-16H,3-8H2,1-2H3 |
| InChIKey | QTFVOSKDPKVLNM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.11 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|