C12H24BN3O4 — CID 66777084
[1-[(2R)-2-(ethylcarbamoylamino)-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid (PubChem CID 66777084) has the molecular formula C12H24BN3O4 and a molecular weight of 285.15 g/mol. Its IUPAC name is [1-[(2R)-2-(ethylcarbamoylamino)-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [1-[(2R)-2-(ethylcarbamoylamino)-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 66777084 |
| Molecular Formula | C12H24BN3O4 |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | [1-[(2R)-2-(ethylcarbamoylamino)-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid |
| SMILES | CCNC(=O)N[C@@H](C(=O)N1CCCC1B(O)O)C(C)C |
| InChI | InChI=1S/C12H24BN3O4/c1-4-14-12(18)15-10(8(2)3)11(17)16-7-5-6-9(16)13(19)20/h8-10,19-20H,4-7H2,1-3H3,(H2,14,15,18)/t9?,10-/m1/s1 |
| InChIKey | PUHNKEIEKGBUJL-QVDQXJPCSA-N |
| XLogP | -0.67 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|