C9H19BN2O3 — CID 59336843
[1-(2-aminopentanoyl)pyrrolidin-2-yl]boronic acid (PubChem CID 59336843) has the molecular formula C9H19BN2O3 and a molecular weight of 214.07 g/mol. Its IUPAC name is [1-(2-aminopentanoyl)pyrrolidin-2-yl]boronic acid.
| Compound Name | [1-(2-aminopentanoyl)pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 59336843 |
| Molecular Formula | C9H19BN2O3 |
| Molecular Weight | 214.07 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | [1-(2-aminopentanoyl)pyrrolidin-2-yl]boronic acid |
| SMILES | CCCC(N)C(=O)N1CCCC1B(O)O |
| InChI | InChI=1S/C9H19BN2O3/c1-2-4-7(11)9(13)12-6-3-5-8(12)10(14)15/h7-8,14-15H,2-6,11H2,1H3 |
| InChIKey | LVJQJXNVLIWBJD-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.07 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|