C13H18BN3O4 — CID 78139880
[1-[2-(pyridine-4-carbonylamino)propanoyl]pyrrolidin-2-yl]boronic acid (PubChem CID 78139880) has the molecular formula C13H18BN3O4 and a molecular weight of 291.12 g/mol. Its IUPAC name is [1-[2-(pyridine-4-carbonylamino)propanoyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [1-[2-(pyridine-4-carbonylamino)propanoyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 78139880 |
| Molecular Formula | C13H18BN3O4 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | [1-[2-(pyridine-4-carbonylamino)propanoyl]pyrrolidin-2-yl]boronic acid |
| SMILES | CC(NC(=O)c1ccncc1)C(=O)N1CCCC1B(O)O |
| InChI | InChI=1S/C13H18BN3O4/c1-9(16-12(18)10-4-6-15-7-5-10)13(19)17-8-2-3-11(17)14(20)21/h4-7,9,11,20-21H,2-3,8H2,1H3,(H,16,18) |
| InChIKey | DRBWRJPFNOBNIO-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|