C13H20BN5O4 — CID 175526481
[(2R)-1-[2-[(6-hydrazinylpyridine-3-carbonyl)amino]propanoyl]pyrrolidin-2-yl]boronic acid (PubChem CID 175526481) has the molecular formula C13H20BN5O4 and a molecular weight of 321.15 g/mol. Its IUPAC name is [(2R)-1-[2-[(6-hydrazinylpyridine-3-carbonyl)amino]propanoyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[2-[(6-hydrazinylpyridine-3-carbonyl)amino]propanoyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 175526481 |
| Molecular Formula | C13H20BN5O4 |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | [(2R)-1-[2-[(6-hydrazinylpyridine-3-carbonyl)amino]propanoyl]pyrrolidin-2-yl]boronic acid |
| SMILES | CC(NC(=O)c1ccc(NN)nc1)C(=O)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C13H20BN5O4/c1-8(13(21)19-6-2-3-10(19)14(22)23)17-12(20)9-4-5-11(18-15)16-7-9/h4-5,7-8,10,22-23H,2-3,6,15H2,1H3,(H,16,18)(H,17,20)/t8?,10-/m0/s1 |
| InChIKey | BKGIAHIXDJMMGL-HTLJXXAVSA-N |
| XLogP | -1.51 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|