C10H15N5O2 — CID 62249334
6-hydrazinyl-N-[1-(methylamino)-1-oxopropan-2-yl]pyridine-3-carboxamide (PubChem CID 62249334) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 6-hydrazinyl-N-[1-(methylamino)-1-oxopropan-2-yl]pyridine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-[1-(methylamino)-1-oxopropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62249334 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 6-hydrazinyl-N-[1-(methylamino)-1-oxopropan-2-yl]pyridine-3-carboxamide |
| SMILES | CNC(=O)C(C)NC(=O)c1ccc(NN)nc1 |
| InChI | InChI=1S/C10H15N5O2/c1-6(9(16)12-2)14-10(17)7-3-4-8(15-11)13-5-7/h3-6H,11H2,1-2H3,(H,12,16)(H,13,15)(H,14,17) |
| InChIKey | DXSFENYVWQCIGR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|