C7H10N4OTc — CID 2826732
6-hydrazinyl-N-methylpyridine-3-carboxamide;technetium-99 (PubChem CID 2826732) has the molecular formula C7H10N4OTc and a molecular weight of 265.09 g/mol. Its IUPAC name is 6-hydrazinyl-N-methylpyridine-3-carboxamide;technetium-99.
| Compound Name | 6-hydrazinyl-N-methylpyridine-3-carboxamide;technetium-99 |
|---|---|
| PubChem CID | 2826732 |
| Molecular Formula | C7H10N4OTc |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 6-hydrazinyl-N-methylpyridine-3-carboxamide;technetium-99 |
| SMILES | CNC(=O)c1ccc(NN)nc1.[99Tc] |
| InChI | InChI=1S/C7H10N4O.Tc/c1-9-7(12)5-2-3-6(11-8)10-4-5;/h2-4H,8H2,1H3,(H,9,12)(H,10,11);/i;1+1 |
| InChIKey | AQARGJBJSKFXBI-IEOVAKBOSA-N |
| XLogP | -0.28 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|