About hydrazine;6-hydrazinylpyridine-3-carboxylic acid
hydrazine;6-hydrazinylpyridine-3-carboxylic acid (PubChem CID 166604204) has the molecular formula C6H11N5O2
and a molecular weight of 185.19 g/mol. Its IUPAC name is hydrazine;6-hydrazinylpyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | hydrazine;6-hydrazinylpyridine-3-carboxylic acid |
| PubChem CID | 166604204 |
| Molecular Formula | C6H11N5O2 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | hydrazine;6-hydrazinylpyridine-3-carboxylic acid |
| SMILES | NN.NNc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C6H7N3O2.H4N2/c7-9-5-2-1-4(3-8-5)6(10)11;1-2/h1-3H,7H2,(H,8,9)(H,10,11);1-2H2 |
| InChIKey | JAOMMRSPAHUEEY-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 140.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;6-hydrazinylpyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;6-hydrazinylpyridine-3-carboxylic acid?
The IUPAC name of hydrazine;6-hydrazinylpyridine-3-carboxylic acid (CID 166604204) is hydrazine;6-hydrazinylpyridine-3-carboxylic acid.
What is the SMILES notation for hydrazine;6-hydrazinylpyridine-3-carboxylic acid?
The canonical SMILES for hydrazine;6-hydrazinylpyridine-3-carboxylic acid is NN.NNc1ccc(C(=O)O)cn1.
What is the InChIKey of hydrazine;6-hydrazinylpyridine-3-carboxylic acid?
The InChIKey is JAOMMRSPAHUEEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2.H4N2/c7-9-5-2-1-4(3-8-5)6(10)11;1-2/h1-3H,7H2,(H,8,9)(H,10,11);1-2H2.
What are the key properties of hydrazine;6-hydrazinylpyridine-3-carboxylic acid?
hydrazine;6-hydrazinylpyridine-3-carboxylic acid has a molecular weight of 185.19 g/mol, XLogP of -1.12, 2 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;6-hydrazinylpyridine-3-carboxylic acid is sourced from PubChem (CID 166604204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).