C13H18N6O5 — CID 134519898
1-[amino(2-oxopropyl)amino]pyrrolidine-2,5-dione;6-hydrazinylpyridine-3-carboxylic acid (PubChem CID 134519898) has the molecular formula C13H18N6O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is 1-[amino(2-oxopropyl)amino]pyrrolidine-2,5-dione;6-hydrazinylpyridine-3-carboxylic acid.
| Compound Name | 1-[amino(2-oxopropyl)amino]pyrrolidine-2,5-dione;6-hydrazinylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 134519898 |
| Molecular Formula | C13H18N6O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-[amino(2-oxopropyl)amino]pyrrolidine-2,5-dione;6-hydrazinylpyridine-3-carboxylic acid |
| SMILES | CC(=O)CN(N)N1C(=O)CCC1=O.NNc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C7H11N3O3.C6H7N3O2/c1-5(11)4-9(8)10-6(12)2-3-7(10)13;7-9-5-2-1-4(3-8-5)6(10)11/h2-4,8H2,1H3;1-3H,7H2,(H,8,9)(H,10,11) |
| InChIKey | ULFGRUWSYPEJGY-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 171.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|