C12H23BN2O3 — CID 11368811
[(2R)-1-[(2S)-2-(cyclopentylamino)propanoyl]pyrrolidin-2-yl]boronic acid (PubChem CID 11368811) has the molecular formula C12H23BN2O3 and a molecular weight of 254.14 g/mol. Its IUPAC name is [(2R)-1-[(2S)-2-(cyclopentylamino)propanoyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[(2S)-2-(cyclopentylamino)propanoyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 11368811 |
| Molecular Formula | C12H23BN2O3 |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | [(2R)-1-[(2S)-2-(cyclopentylamino)propanoyl]pyrrolidin-2-yl]boronic acid |
| SMILES | C[C@H](NC1CCCC1)C(=O)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C12H23BN2O3/c1-9(14-10-5-2-3-6-10)12(16)15-8-4-7-11(15)13(17)18/h9-11,14,17-18H,2-8H2,1H3/t9-,11-/m0/s1 |
| InChIKey | BHFZEVQXINCZGX-ONGXEEELSA-N |
| XLogP | -0.09 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|