C19H35BN4O5 — CID 70876607
[(2R)-1-[2-[[(2S)-2-[(2-amino-2-cyclohexylacetyl)amino]propanoyl]amino]butanoyl]pyrrolidin-2-yl]boronic acid (PubChem CID 70876607) has the molecular formula C19H35BN4O5 and a molecular weight of 410.32 g/mol. Its IUPAC name is [(2R)-1-[2-[[(2S)-2-[(2-amino-2-cyclohexylacetyl)amino]propanoyl]amino]butanoyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[2-[[(2S)-2-[(2-amino-2-cyclohexylacetyl)amino]propanoyl]amino]butanoyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 70876607 |
| Molecular Formula | C19H35BN4O5 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | [(2R)-1-[2-[[(2S)-2-[(2-amino-2-cyclohexylacetyl)amino]propanoyl]amino]butanoyl]pyrrolidin-2-yl]boronic acid |
| SMILES | CCC(NC(=O)[C@H](C)NC(=O)C(N)C1CCCCC1)C(=O)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C19H35BN4O5/c1-3-14(19(27)24-11-7-10-15(24)20(28)29)23-17(25)12(2)22-18(26)16(21)13-8-5-4-6-9-13/h12-16,28-29H,3-11,21H2,1-2H3,(H,22,26)(H,23,25)/t12-,14?,15-,16?/m0/s1 |
| InChIKey | LVNARYLUGHLFSR-IYOFFGIQSA-N |
| XLogP | -0.70 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|