C12H22N2O4 — CID 126679555
methyl (2S)-2-[[(2S)-2-amino-2-cyclohexylacetyl]amino]-3-hydroxypropanoate (PubChem CID 126679555) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-2-cyclohexylacetyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-2-cyclohexylacetyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 126679555 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-2-cyclohexylacetyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)[C@@H](N)C1CCCCC1 |
| InChI | InChI=1S/C12H22N2O4/c1-18-12(17)9(7-15)14-11(16)10(13)8-5-3-2-4-6-8/h8-10,15H,2-7,13H2,1H3,(H,14,16)/t9-,10-/m0/s1 |
| InChIKey | SXASRFWOCLZHPC-UWVGGRQHSA-N |
| XLogP | -0.46 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |