C19H34N2O3 — CID 171080468
methyl 2-[(2-amino-3-cyclohexylpropanoyl)amino]-3-cyclohexylpropanoate (PubChem CID 171080468) has the molecular formula C19H34N2O3 and a molecular weight of 338.49 g/mol. Its IUPAC name is methyl 2-[(2-amino-3-cyclohexylpropanoyl)amino]-3-cyclohexylpropanoate.
| Compound Name | methyl 2-[(2-amino-3-cyclohexylpropanoyl)amino]-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 171080468 |
| Molecular Formula | C19H34N2O3 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | methyl 2-[(2-amino-3-cyclohexylpropanoyl)amino]-3-cyclohexylpropanoate |
| SMILES | COC(=O)C(CC1CCCCC1)NC(=O)C(N)CC1CCCCC1 |
| InChI | InChI=1S/C19H34N2O3/c1-24-19(23)17(13-15-10-6-3-7-11-15)21-18(22)16(20)12-14-8-4-2-5-9-14/h14-17H,2-13,20H2,1H3,(H,21,22) |
| InChIKey | GPHOUZGFBNMGCX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |