C15H27N3O4 — CID 170007664
methyl (2S,4S)-2-[[(2S)-2-amino-3-cyclopropylpropanoyl]amino]-4-formyl-6-(methylamino)hexanoate (PubChem CID 170007664) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl (2S,4S)-2-[[(2S)-2-amino-3-cyclopropylpropanoyl]amino]-4-formyl-6-(methylamino)hexanoate.
| Compound Name | methyl (2S,4S)-2-[[(2S)-2-amino-3-cyclopropylpropanoyl]amino]-4-formyl-6-(methylamino)hexanoate |
|---|---|
| PubChem CID | 170007664 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | methyl (2S,4S)-2-[[(2S)-2-amino-3-cyclopropylpropanoyl]amino]-4-formyl-6-(methylamino)hexanoate |
| SMILES | CNCC[C@H](C=O)C[C@H](NC(=O)[C@@H](N)CC1CC1)C(=O)OC |
| InChI | InChI=1S/C15H27N3O4/c1-17-6-5-11(9-19)8-13(15(21)22-2)18-14(20)12(16)7-10-3-4-10/h9-13,17H,3-8,16H2,1-2H3,(H,18,20)/t11-,12-,13-/m0/s1 |
| InChIKey | VYSJFPLXLVTIRM-AVGNSLFASA-N |
| XLogP | -0.41 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|