C21H39N3O5 — CID 10811693
methyl (2R)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-cyclohexylpropanoate (PubChem CID 10811693) has the molecular formula C21H39N3O5 and a molecular weight of 413.56 g/mol. Its IUPAC name is methyl (2R)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-cyclohexylpropanoate.
| Compound Name | methyl (2R)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 10811693 |
| Molecular Formula | C21H39N3O5 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | methyl (2R)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-cyclohexylpropanoate |
| SMILES | COC(=O)[C@@H](CC1CCCCC1)NC(=O)[C@@H](N)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39N3O5/c1-21(2,3)29-20(27)23-13-9-8-12-16(22)18(25)24-17(19(26)28-4)14-15-10-6-5-7-11-15/h15-17H,5-14,22H2,1-4H3,(H,23,27)(H,24,25)/t16-,17+/m0/s1 |
| InChIKey | NEGJYNVMLJUXBV-DLBZAZTESA-N |
| XLogP | 2.64 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|