C23H41N3O6 — CID 70403345
methyl 6-[[(2S)-3-cyclohexyl-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoyl]amino]hexanoate (PubChem CID 70403345) has the molecular formula C23H41N3O6 and a molecular weight of 455.60 g/mol. Its IUPAC name is methyl 6-[[(2S)-3-cyclohexyl-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoyl]amino]hexanoate.
| Compound Name | methyl 6-[[(2S)-3-cyclohexyl-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 70403345 |
| Molecular Formula | C23H41N3O6 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | methyl 6-[[(2S)-3-cyclohexyl-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)[C@H](CC1CCCCC1)NC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H41N3O6/c1-23(2,3)32-22(30)25-16-19(27)26-18(15-17-11-7-5-8-12-17)21(29)24-14-10-6-9-13-20(28)31-4/h17-18H,5-16H2,1-4H3,(H,24,29)(H,25,30)(H,26,27)/t18-/m0/s1 |
| InChIKey | ZHYJBFPKKSVLTM-SFHVURJKSA-N |
| XLogP | 2.82 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|