C21H39N3O3 — CID 67038034
tert-butyl N-[(2S)-3-cyclohexyl-1-oxo-1-(2-piperidin-1-ylethylamino)propan-2-yl]carbamate (PubChem CID 67038034) has the molecular formula C21H39N3O3 and a molecular weight of 381.56 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-cyclohexyl-1-oxo-1-(2-piperidin-1-ylethylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-cyclohexyl-1-oxo-1-(2-piperidin-1-ylethylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 67038034 |
| Molecular Formula | C21H39N3O3 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | tert-butyl N-[(2S)-3-cyclohexyl-1-oxo-1-(2-piperidin-1-ylethylamino)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1CCCCC1)C(=O)NCCN1CCCCC1 |
| InChI | InChI=1S/C21H39N3O3/c1-21(2,3)27-20(26)23-18(16-17-10-6-4-7-11-17)19(25)22-12-15-24-13-8-5-9-14-24/h17-18H,4-16H2,1-3H3,(H,22,25)(H,23,26)/t18-/m0/s1 |
| InChIKey | HJVYALKIJSNAJK-SFHVURJKSA-N |
| XLogP | 3.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |