About N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide
N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide (PubChem CID 67038034) has the molecular formula C21H39N3O3
and a molecular weight of 381.60 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-cyclohexyl-1-oxo-1-(2-piperidin-1-ylethylamino)propan-2-yl]carbamate.
Molecular Properties
| Compound Name | N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide |
| PubChem CID | 67038034 |
| Molecular Formula | C21H39N3O3 |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | tert-butyl N-[(2S)-3-cyclohexyl-1-oxo-1-(2-piperidin-1-ylethylamino)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1CCCCC1)C(=O)NCCN2CCCCC2 |
| InChI | InChI=1S/C21H39N3O3/c1-21(2,3)27-20(26)23-18(16-17-10-6-4-7-11-17)19(25)22-12-15-24-13-8-5-9-14-24/h17-18H,4-16H2,1-3H3,(H,22,25)(H,23,26)/t18-/m0/s1 |
| InChIKey | HJVYALKIJSNAJK-SFHVURJKSA-N |
| XLogP | 4.30 |
| TPSA | 70.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | 464 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide?
The IUPAC name of N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide (CID 67038034) is tert-butyl N-[(2S)-3-cyclohexyl-1-oxo-1-(2-piperidin-1-ylethylamino)propan-2-yl]carbamate.
What is the SMILES notation for N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide?
The canonical SMILES for N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide is CC(C)(C)OC(=O)N[C@@H](CC1CCCCC1)C(=O)NCCN2CCCCC2.
What is the InChIKey of N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide?
The InChIKey is HJVYALKIJSNAJK-SFHVURJKSA-N. The full InChI is InChI=1S/C21H39N3O3/c1-21(2,3)27-20(26)23-18(16-17-10-6-4-7-11-17)19(25)22-12-15-24-13-8-5-9-14-24/h17-18H,4-16H2,1-3H3,(H,22,25)(H,23,26)/t18-/m0/s1.
What are the key properties of N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide?
N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide has a molecular weight of 381.60 g/mol, XLogP of 4.30, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-t-butoxycarbonyl-beta-cyclohexyl-L-alanine 2-(1-piperidinyl)ethyl amide is sourced from PubChem (CID 67038034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).