C26H48N2O4 — CID 75412573
(2S)-3-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;dicyclohexylazanium (PubChem CID 75412573) has the molecular formula C26H48N2O4 and a molecular weight of 452.68 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;dicyclohexylazanium.
| Compound Name | (2S)-3-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;dicyclohexylazanium |
|---|---|
| PubChem CID | 75412573 |
| Molecular Formula | C26H48N2O4 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.36 |
| IUPAC Name | (2S)-3-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;dicyclohexylazanium |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.CC(C)(C)OC(=O)N[C@@H](CC1CCCCC1)C(=O)[O-] |
| InChI | InChI=1S/C14H25NO4.C12H23N/c1-14(2,3)19-13(18)15-11(12(16)17)9-10-7-5-4-6-8-10;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h10-11H,4-9H2,1-3H3,(H,15,18)(H,16,17);11-13H,1-10H2/t11-;/m0./s1 |
| InChIKey | GSGRQFGFPZQUQS-MERQFXBCSA-N |
| XLogP | 3.82 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |