C15H29NO2 — CID 70327629
tert-butyl N-[(2R)-1-cyclohexylbutan-2-yl]carbamate (PubChem CID 70327629) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-cyclohexylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-cyclohexylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70327629 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | tert-butyl N-[(2R)-1-cyclohexylbutan-2-yl]carbamate |
| SMILES | CC[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO2/c1-5-13(11-12-9-7-6-8-10-12)16-14(17)18-15(2,3)4/h12-13H,5-11H2,1-4H3,(H,16,17)/t13-/m1/s1 |
| InChIKey | SKIPGYLAJWDBBC-CYBMUJFWSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |