C21H39NO3 — CID 56988028
tert-butyl N-[(2S,4S,5R)-1-cyclohexyl-4-hydroxy-5-propan-2-ylhept-6-en-2-yl]carbamate (PubChem CID 56988028) has the molecular formula C21H39NO3 and a molecular weight of 353.55 g/mol. Its IUPAC name is tert-butyl N-[(2S,4S,5R)-1-cyclohexyl-4-hydroxy-5-propan-2-ylhept-6-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,4S,5R)-1-cyclohexyl-4-hydroxy-5-propan-2-ylhept-6-en-2-yl]carbamate |
|---|---|
| PubChem CID | 56988028 |
| Molecular Formula | C21H39NO3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.29 |
| IUPAC Name | tert-butyl N-[(2S,4S,5R)-1-cyclohexyl-4-hydroxy-5-propan-2-ylhept-6-en-2-yl]carbamate |
| SMILES | C=C[C@@H](C(C)C)[C@@H](O)C[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39NO3/c1-7-18(15(2)3)19(23)14-17(13-16-11-9-8-10-12-16)22-20(24)25-21(4,5)6/h7,15-19,23H,1,8-14H2,2-6H3,(H,22,24)/t17-,18-,19-/m0/s1 |
| InChIKey | ZOJOPUPDIGVXRZ-FHWLQOOXSA-N |
| XLogP | 5.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|