C14H26BN3O9 — CID 73203880
2,3-dihydroxybutanedioic acid;[1-[2-(pyrrolidin-3-ylamino)acetyl]pyrrolidin-2-yl]boronic acid (PubChem CID 73203880) has the molecular formula C14H26BN3O9 and a molecular weight of 391.19 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;[1-[2-(pyrrolidin-3-ylamino)acetyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | 2,3-dihydroxybutanedioic acid;[1-[2-(pyrrolidin-3-ylamino)acetyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 73203880 |
| Molecular Formula | C14H26BN3O9 |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;[1-[2-(pyrrolidin-3-ylamino)acetyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C(CNC1CCNC1)N1CCCC1B(O)O.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C10H20BN3O3.C4H6O6/c15-10(7-13-8-3-4-12-6-8)14-5-1-2-9(14)11(16)17;5-1(3(7)8)2(6)4(9)10/h8-9,12-13,16-17H,1-7H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | SVWHNLVZPGXBNS-UHFFFAOYSA-N |
| XLogP | -4.18 |
| TPSA | 199.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|