C17H26BN3O3 — CID 11998064
[(2R)-1-[2-[[(3R)-3-benzylpyrrolidin-3-yl]amino]acetyl]pyrrolidin-2-yl]boronic acid (PubChem CID 11998064) has the molecular formula C17H26BN3O3 and a molecular weight of 331.22 g/mol. Its IUPAC name is [(2R)-1-[2-[[(3R)-3-benzylpyrrolidin-3-yl]amino]acetyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[2-[[(3R)-3-benzylpyrrolidin-3-yl]amino]acetyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 11998064 |
| Molecular Formula | C17H26BN3O3 |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | [(2R)-1-[2-[[(3R)-3-benzylpyrrolidin-3-yl]amino]acetyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C(CN[C@]1(Cc2ccccc2)CCNC1)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C17H26BN3O3/c22-16(21-10-4-7-15(21)18(23)24)12-20-17(8-9-19-13-17)11-14-5-2-1-3-6-14/h1-3,5-6,15,19-20,23-24H,4,7-13H2/t15-,17-/m0/s1 |
| InChIKey | YXARDGXMSWSMIR-RDJZCZTQSA-N |
| XLogP | -0.45 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|