C20H34BN3O3 — CID 59273553
2-[[(3R)-pyrrolidin-3-yl]amino]-1-[2-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethanone (PubChem CID 59273553) has the molecular formula C20H34BN3O3 and a molecular weight of 375.32 g/mol. Its IUPAC name is 2-[[(3R)-pyrrolidin-3-yl]amino]-1-[2-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-[[(3R)-pyrrolidin-3-yl]amino]-1-[2-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 59273553 |
| Molecular Formula | C20H34BN3O3 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | 2-[[(3R)-pyrrolidin-3-yl]amino]-1-[2-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC1(C)[C@@H]2C[C@H]1[C@]1(C)OB(C3CCCN3C(=O)CN[C@@H]3CCNC3)O[C@@H]1C2 |
| InChI | InChI=1S/C20H34BN3O3/c1-19(2)13-9-15(19)20(3)16(10-13)26-21(27-20)17-5-4-8-24(17)18(25)12-23-14-6-7-22-11-14/h13-17,22-23H,4-12H2,1-3H3/t13-,14-,15-,16-,17?,20+/m1/s1 |
| InChIKey | GVKYDJCQMGKHJA-OUHXMZDTSA-N |
| XLogP | 1.20 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|