C19H36BN3O3 — CID 71667671
(2S)-2,6-diamino-N-[(2R)-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-2-yl]hexanamide (PubChem CID 71667671) has the molecular formula C19H36BN3O3 and a molecular weight of 365.33 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2R)-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2R)-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-2-yl]hexanamide |
|---|---|
| PubChem CID | 71667671 |
| Molecular Formula | C19H36BN3O3 |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2R)-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-2-yl]hexanamide |
| SMILES | C[C@H](CB1OC2CC3CC(C3(C)C)[C@@]2(C)O1)NC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C19H36BN3O3/c1-12(23-17(24)14(22)7-5-6-8-21)11-20-25-16-10-13-9-15(18(13,2)3)19(16,4)26-20/h12-16H,5-11,21-22H2,1-4H3,(H,23,24)/t12-,13?,14+,15?,16?,19-/m1/s1 |
| InChIKey | NVSVJSYZDXDSPA-MZCWAUSFSA-N |
| XLogP | 1.68 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|