C19H37BClN3O3 — CID 86576278
[(2S)-6-amino-1-oxo-1-[[(2R)-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]hexan-2-yl]azanium chloride (PubChem CID 86576278) has the molecular formula C19H37BClN3O3 and a molecular weight of 401.79 g/mol. Its IUPAC name is [(2S)-6-amino-1-oxo-1-[[(2R)-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]hexan-2-yl]azanium chloride.
| Compound Name | [(2S)-6-amino-1-oxo-1-[[(2R)-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]hexan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 86576278 |
| Molecular Formula | C19H37BClN3O3 |
| Molecular Weight | 401.79 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | [(2S)-6-amino-1-oxo-1-[[(2R)-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]hexan-2-yl]azanium chloride |
| SMILES | C[C@H](CNC(=O)[C@@H]([NH3+])CCCCN)B1O[C@H]2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1.[Cl-] |
| InChI | InChI=1S/C19H36BN3O3.ClH/c1-12(11-23-17(24)14(22)7-5-6-8-21)20-25-16-10-13-9-15(18(13,2)3)19(16,4)26-20;/h12-16H,5-11,21-22H2,1-4H3,(H,23,24);1H/t12-,13-,14+,15-,16+,19-;/m1./s1 |
| InChIKey | QUCCZTSXKBDPSI-NWRLTNHSSA-N |
| XLogP | -2.04 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.79 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|