C28H51BClN3O4 — CID 86577585
[(2R)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-1-[[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexyl]amino]propan-2-yl]amino]propan-2-yl]azanium chloride (PubChem CID 86577585) has the molecular formula C28H51BClN3O4 and a molecular weight of 540.00 g/mol. Its IUPAC name is [(2R)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-1-[[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexyl]amino]propan-2-yl]amino]propan-2-yl]azanium chloride.
| Compound Name | [(2R)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-1-[[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexyl]amino]propan-2-yl]amino]propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 86577585 |
| Molecular Formula | C28H51BClN3O4 |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 539.37 |
| IUPAC Name | [(2R)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-1-[[(1R)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexyl]amino]propan-2-yl]amino]propan-2-yl]azanium chloride |
| SMILES | CCCCC[C@H](NC(=O)[C@H](C)NC(=O)[C@H]([NH3+])CC1CCCCC1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1.[Cl-] |
| InChI | InChI=1S/C28H50BN3O4.ClH/c1-6-7-9-14-24(29-35-23-17-20-16-22(27(20,3)4)28(23,5)36-29)32-25(33)18(2)31-26(34)21(30)15-19-12-10-8-11-13-19;/h18-24H,6-17,30H2,1-5H3,(H,31,34)(H,32,33);1H/t18-,20-,21+,22-,23+,24-,28-;/m0./s1 |
| InChIKey | TUHQKKMTCSPZEO-KZJFKCOGSA-N |
| XLogP | 0.41 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|