C18H35BClN3O3 — CID 86576279
[(2S)-6-amino-1-oxo-1-[2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylamino]hexan-2-yl]azanium chloride (PubChem CID 86576279) has the molecular formula C18H35BClN3O3 and a molecular weight of 387.76 g/mol. Its IUPAC name is [(2S)-6-amino-1-oxo-1-[2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylamino]hexan-2-yl]azanium chloride.
| Compound Name | [(2S)-6-amino-1-oxo-1-[2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylamino]hexan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 86576279 |
| Molecular Formula | C18H35BClN3O3 |
| Molecular Weight | 387.76 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | [(2S)-6-amino-1-oxo-1-[2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylamino]hexan-2-yl]azanium chloride |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB(CCNC(=O)[C@@H]([NH3+])CCCCN)O[C@]3(C)[C@@H]1C2.[Cl-] |
| InChI | InChI=1S/C18H34BN3O3.ClH/c1-17(2)12-10-14(17)18(3)15(11-12)24-19(25-18)7-9-22-16(23)13(21)6-4-5-8-20;/h12-15H,4-11,20-21H2,1-3H3,(H,22,23);1H/t12-,13+,14-,15+,18-;/m1./s1 |
| InChIKey | YMWNKARWEQTOLE-GERPNHDRSA-N |
| XLogP | -2.43 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.76 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|