C16H24BN3O5S — CID 11211207
[(2R)-1-[2-[[(3R)-1-(benzenesulfonyl)pyrrolidin-3-yl]amino]acetyl]pyrrolidin-2-yl]boronic acid (PubChem CID 11211207) has the molecular formula C16H24BN3O5S and a molecular weight of 381.26 g/mol. Its IUPAC name is [(2R)-1-[2-[[(3R)-1-(benzenesulfonyl)pyrrolidin-3-yl]amino]acetyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[2-[[(3R)-1-(benzenesulfonyl)pyrrolidin-3-yl]amino]acetyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 11211207 |
| Molecular Formula | C16H24BN3O5S |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [(2R)-1-[2-[[(3R)-1-(benzenesulfonyl)pyrrolidin-3-yl]amino]acetyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C(CN[C@@H]1CCN(S(=O)(=O)c2ccccc2)C1)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C16H24BN3O5S/c21-16(20-9-4-7-15(20)17(22)23)11-18-13-8-10-19(12-13)26(24,25)14-5-2-1-3-6-14/h1-3,5-6,13,15,18,22-23H,4,7-12H2/t13-,15+/m1/s1 |
| InChIKey | GVOUGLGUZIFYCG-HIFRSBDPSA-N |
| XLogP | -0.96 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|