C16H24BN3O7S2 — CID 11352121
[(2R)-1-[(2S)-4-(4-methylsulfonylphenyl)sulfonylpiperazine-2-carbonyl]pyrrolidin-2-yl]boronic acid (PubChem CID 11352121) has the molecular formula C16H24BN3O7S2 and a molecular weight of 445.33 g/mol. Its IUPAC name is [(2R)-1-[(2S)-4-(4-methylsulfonylphenyl)sulfonylpiperazine-2-carbonyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[(2S)-4-(4-methylsulfonylphenyl)sulfonylpiperazine-2-carbonyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 11352121 |
| Molecular Formula | C16H24BN3O7S2 |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [(2R)-1-[(2S)-4-(4-methylsulfonylphenyl)sulfonylpiperazine-2-carbonyl]pyrrolidin-2-yl]boronic acid |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCN[C@H](C(=O)N3CCC[C@H]3B(O)O)C2)cc1 |
| InChI | InChI=1S/C16H24BN3O7S2/c1-28(24,25)12-4-6-13(7-5-12)29(26,27)19-10-8-18-14(11-19)16(21)20-9-2-3-15(20)17(22)23/h4-7,14-15,18,22-23H,2-3,8-11H2,1H3/t14-,15-/m0/s1 |
| InChIKey | LIVLXTKPEWPUOI-GJZGRUSLSA-N |
| XLogP | -1.94 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|