C16H20BClF3N3O5S — CID 89074571
[(2R)-1-[(2R)-1-chloro-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine-2-carbonyl]pyrrolidin-2-yl]boronic acid (PubChem CID 89074571) has the molecular formula C16H20BClF3N3O5S and a molecular weight of 469.68 g/mol. Its IUPAC name is [(2R)-1-[(2R)-1-chloro-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine-2-carbonyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[(2R)-1-chloro-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine-2-carbonyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 89074571 |
| Molecular Formula | C16H20BClF3N3O5S |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | [(2R)-1-[(2R)-1-chloro-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine-2-carbonyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C([C@H]1CN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CCN1Cl)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C16H20BClF3N3O5S/c18-24-9-8-22(10-13(24)15(25)23-7-1-2-14(23)17(26)27)30(28,29)12-5-3-11(4-6-12)16(19,20)21/h3-6,13-14,26-27H,1-2,7-10H2/t13-,14+/m1/s1 |
| InChIKey | KRSYXPFPGOSHJB-KGLIPLIRSA-N |
| XLogP | 0.54 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|