C16H20F3N3O3S — CID 121154179
1-[1-[4-(trifluoromethyl)phenyl]sulfonylazetidin-3-yl]piperidine-4-carboxamide (PubChem CID 121154179) has the molecular formula C16H20F3N3O3S and a molecular weight of 391.42 g/mol. Its IUPAC name is 1-[1-[4-(trifluoromethyl)phenyl]sulfonylazetidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[4-(trifluoromethyl)phenyl]sulfonylazetidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121154179 |
| Molecular Formula | C16H20F3N3O3S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-[1-[4-(trifluoromethyl)phenyl]sulfonylazetidin-3-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)C2)CC1 |
| InChI | InChI=1S/C16H20F3N3O3S/c17-16(18,19)12-1-3-14(4-2-12)26(24,25)22-9-13(10-22)21-7-5-11(6-8-21)15(20)23/h1-4,11,13H,5-10H2,(H2,20,23) |
| InChIKey | UZLRGGAREVXSPD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |