C16H20N4O3S — CID 121154210
1-[1-(2-cyanophenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide (PubChem CID 121154210) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 1-[1-(2-cyanophenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-(2-cyanophenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121154210 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-[1-(2-cyanophenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CC(N2CCC(C(N)=O)CC2)C1 |
| InChI | InChI=1S/C16H20N4O3S/c17-9-13-3-1-2-4-15(13)24(22,23)20-10-14(11-20)19-7-5-12(6-8-19)16(18)21/h1-4,12,14H,5-8,10-11H2,(H2,18,21) |
| InChIKey | QSDRUMXFMYOXJS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |