C15H19F2N3O3S — CID 121154153
1-[1-(2,6-difluorophenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide (PubChem CID 121154153) has the molecular formula C15H19F2N3O3S and a molecular weight of 359.40 g/mol. Its IUPAC name is 1-[1-(2,6-difluorophenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-(2,6-difluorophenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121154153 |
| Molecular Formula | C15H19F2N3O3S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-[1-(2,6-difluorophenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2CN(S(=O)(=O)c3c(F)cccc3F)C2)CC1 |
| InChI | InChI=1S/C15H19F2N3O3S/c16-12-2-1-3-13(17)14(12)24(22,23)20-8-11(9-20)19-6-4-10(5-7-19)15(18)21/h1-3,10-11H,4-9H2,(H2,18,21) |
| InChIKey | UMTBNFUKDKKWJR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |