C15H20F2N2O3S — CID 97415192
(3S)-1-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]pyrrolidin-3-ol (PubChem CID 97415192) has the molecular formula C15H20F2N2O3S and a molecular weight of 346.40 g/mol. Its IUPAC name is (3S)-1-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 97415192 |
| Molecular Formula | C15H20F2N2O3S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (3S)-1-[1-(2,6-difluorophenyl)sulfonylpiperidin-4-yl]pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCC(N2CC[C@H](O)C2)CC1 |
| InChI | InChI=1S/C15H20F2N2O3S/c16-13-2-1-3-14(17)15(13)23(21,22)19-8-4-11(5-9-19)18-7-6-12(20)10-18/h1-3,11-12,20H,4-10H2/t12-/m0/s1 |
| InChIKey | HCQFWLQJVPJVEF-LBPRGKRZSA-N |
| XLogP | 1.18 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |