C17H24F2N2O3S — CID 90616613
1-(2,6-difluorophenyl)sulfonyl-4-(4-methoxypiperidin-1-yl)piperidine (PubChem CID 90616613) has the molecular formula C17H24F2N2O3S and a molecular weight of 374.45 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)sulfonyl-4-(4-methoxypiperidin-1-yl)piperidine.
| Compound Name | 1-(2,6-difluorophenyl)sulfonyl-4-(4-methoxypiperidin-1-yl)piperidine |
|---|---|
| PubChem CID | 90616613 |
| Molecular Formula | C17H24F2N2O3S |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-(2,6-difluorophenyl)sulfonyl-4-(4-methoxypiperidin-1-yl)piperidine |
| SMILES | COC1CCN(C2CCN(S(=O)(=O)c3c(F)cccc3F)CC2)CC1 |
| InChI | InChI=1S/C17H24F2N2O3S/c1-24-14-7-9-20(10-8-14)13-5-11-21(12-6-13)25(22,23)17-15(18)3-2-4-16(17)19/h2-4,13-14H,5-12H2,1H3 |
| InChIKey | FEOAZEUPSUNDKW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |