C21H25ClN2O3S — CID 97415211
(3R)-1-[1-[4-(3-chlorophenyl)phenyl]sulfonylpiperidin-4-yl]pyrrolidin-3-ol (PubChem CID 97415211) has the molecular formula C21H25ClN2O3S and a molecular weight of 420.96 g/mol. Its IUPAC name is (3R)-1-[1-[4-(3-chlorophenyl)phenyl]sulfonylpiperidin-4-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[1-[4-(3-chlorophenyl)phenyl]sulfonylpiperidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 97415211 |
| Molecular Formula | C21H25ClN2O3S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (3R)-1-[1-[4-(3-chlorophenyl)phenyl]sulfonylpiperidin-4-yl]pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccc(-c2cccc(Cl)c2)cc1)N1CCC(N2CC[C@@H](O)C2)CC1 |
| InChI | InChI=1S/C21H25ClN2O3S/c22-18-3-1-2-17(14-18)16-4-6-21(7-5-16)28(26,27)24-12-8-19(9-13-24)23-11-10-20(25)15-23/h1-7,14,19-20,25H,8-13,15H2/t20-/m1/s1 |
| InChIKey | RXSUKFQLJKHRLA-HXUWFJFHSA-N |
| XLogP | 3.23 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |