C23H22ClNO4S2 — CID 90589542
4-(benzenesulfonyl)-1-[3-(4-chlorophenyl)phenyl]sulfonylpiperidine (PubChem CID 90589542) has the molecular formula C23H22ClNO4S2 and a molecular weight of 476.02 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1-[3-(4-chlorophenyl)phenyl]sulfonylpiperidine.
| Compound Name | 4-(benzenesulfonyl)-1-[3-(4-chlorophenyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90589542 |
| Molecular Formula | C23H22ClNO4S2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 4-(benzenesulfonyl)-1-[3-(4-chlorophenyl)phenyl]sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccccc1)C1CCN(S(=O)(=O)c2cccc(-c3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C23H22ClNO4S2/c24-20-11-9-18(10-12-20)19-5-4-8-23(17-19)31(28,29)25-15-13-22(14-16-25)30(26,27)21-6-2-1-3-7-21/h1-12,17,22H,13-16H2 |
| InChIKey | CWUDMSAILYQHHU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |