C21H24ClN3O4S — CID 119099937
1-[1-[4-(2-chlorophenoxy)phenyl]sulfonylazetidin-3-yl]piperidine-4-carboxamide (PubChem CID 119099937) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is 1-[1-[4-(2-chlorophenoxy)phenyl]sulfonylazetidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[4-(2-chlorophenoxy)phenyl]sulfonylazetidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119099937 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-[1-[4-(2-chlorophenoxy)phenyl]sulfonylazetidin-3-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2CN(S(=O)(=O)c3ccc(Oc4ccccc4Cl)cc3)C2)CC1 |
| InChI | InChI=1S/C21H24ClN3O4S/c22-19-3-1-2-4-20(19)29-17-5-7-18(8-6-17)30(27,28)25-13-16(14-25)24-11-9-15(10-12-24)21(23)26/h1-8,15-16H,9-14H2,(H2,23,26) |
| InChIKey | GQACHLJRZDSUHL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |