C20H22ClNO3S2 — CID 90616222
8-[4-(2-chlorophenoxy)phenyl]sulfonyl-3-methylsulfanyl-8-azabicyclo[3.2.1]octane (PubChem CID 90616222) has the molecular formula C20H22ClNO3S2 and a molecular weight of 423.99 g/mol. Its IUPAC name is 8-[4-(2-chlorophenoxy)phenyl]sulfonyl-3-methylsulfanyl-8-azabicyclo[3.2.1]octane.
| Compound Name | 8-[4-(2-chlorophenoxy)phenyl]sulfonyl-3-methylsulfanyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 90616222 |
| Molecular Formula | C20H22ClNO3S2 |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 8-[4-(2-chlorophenoxy)phenyl]sulfonyl-3-methylsulfanyl-8-azabicyclo[3.2.1]octane |
| SMILES | CSC1CC2CCC(C1)N2S(=O)(=O)c1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H22ClNO3S2/c1-26-17-12-14-6-7-15(13-17)22(14)27(23,24)18-10-8-16(9-11-18)25-20-5-3-2-4-19(20)21/h2-5,8-11,14-15,17H,6-7,12-13H2,1H3 |
| InChIKey | ZSDRBEVMYRAXAK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |