C18H22Cl2N2O3S — CID 119970878
N-(4-aminocyclohexyl)-4-(2-chlorophenoxy)benzenesulfonamide;hydrochloride (PubChem CID 119970878) has the molecular formula C18H22Cl2N2O3S and a molecular weight of 417.36 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-(2-chlorophenoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-4-(2-chlorophenoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119970878 |
| Molecular Formula | C18H22Cl2N2O3S |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-(2-chlorophenoxy)benzenesulfonamide;hydrochloride |
| SMILES | Cl.NC1CCC(NS(=O)(=O)c2ccc(Oc3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C18H21ClN2O3S.ClH/c19-17-3-1-2-4-18(17)24-15-9-11-16(12-10-15)25(22,23)21-14-7-5-13(20)6-8-14;/h1-4,9-14,21H,5-8,20H2;1H |
| InChIKey | GPFNKQMEWCXWGA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |