C16H20Cl2N2O3S — CID 119972685
N-(3-aminobutyl)-4-(2-chlorophenoxy)benzenesulfonamide;hydrochloride (PubChem CID 119972685) has the molecular formula C16H20Cl2N2O3S and a molecular weight of 391.32 g/mol. Its IUPAC name is N-(3-aminobutyl)-4-(2-chlorophenoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-4-(2-chlorophenoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119972685 |
| Molecular Formula | C16H20Cl2N2O3S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-(3-aminobutyl)-4-(2-chlorophenoxy)benzenesulfonamide;hydrochloride |
| SMILES | CC(N)CCNS(=O)(=O)c1ccc(Oc2ccccc2Cl)cc1.Cl |
| InChI | InChI=1S/C16H19ClN2O3S.ClH/c1-12(18)10-11-19-23(20,21)14-8-6-13(7-9-14)22-16-5-3-2-4-15(16)17;/h2-9,12,19H,10-11,18H2,1H3;1H |
| InChIKey | ASQZXKBBVISQFH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |