C13H17Cl2F3N2O2S — CID 119970603
N-(4-aminocyclohexyl)-4-chloro-3-(trifluoromethyl)benzenesulfonamide;hydrochloride (PubChem CID 119970603) has the molecular formula C13H17Cl2F3N2O2S and a molecular weight of 393.26 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-chloro-3-(trifluoromethyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-4-chloro-3-(trifluoromethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119970603 |
| Molecular Formula | C13H17Cl2F3N2O2S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-chloro-3-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.NC1CCC(NS(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C13H16ClF3N2O2S.ClH/c14-12-6-5-10(7-11(12)13(15,16)17)22(20,21)19-9-3-1-8(18)2-4-9;/h5-9,19H,1-4,18H2;1H |
| InChIKey | RBHGDDJIFKLOCI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |