C11H10F3NO4S — CID 68756811
4-(cyclopropylsulfamoyl)-2-(trifluoromethyl)benzoic acid (PubChem CID 68756811) has the molecular formula C11H10F3NO4S and a molecular weight of 309.27 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoyl)-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(cyclopropylsulfamoyl)-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 68756811 |
| Molecular Formula | C11H10F3NO4S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 4-(cyclopropylsulfamoyl)-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NC2CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO4S/c12-11(13,14)9-5-7(3-4-8(9)10(16)17)20(18,19)15-6-1-2-6/h3-6,15H,1-2H2,(H,16,17) |
| InChIKey | GRKBHJHNBLSWGF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |