C14H14F3NO4S — CID 154805576
4-(3-cyclopropylprop-2-enylsulfamoyl)-2-(trifluoromethyl)benzoic acid (PubChem CID 154805576) has the molecular formula C14H14F3NO4S and a molecular weight of 349.33 g/mol. Its IUPAC name is 4-(3-cyclopropylprop-2-enylsulfamoyl)-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(3-cyclopropylprop-2-enylsulfamoyl)-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 154805576 |
| Molecular Formula | C14H14F3NO4S |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 4-(3-cyclopropylprop-2-enylsulfamoyl)-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCC=CC2CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO4S/c15-14(16,17)12-8-10(5-6-11(12)13(19)20)23(21,22)18-7-1-2-9-3-4-9/h1-2,5-6,8-9,18H,3-4,7H2,(H,19,20) |
| InChIKey | FRBFGQMZJYZINA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|