C13H14F3NO5S — CID 138001320
4-[methyl(oxolan-3-yl)sulfamoyl]-2-(trifluoromethyl)benzoic acid (PubChem CID 138001320) has the molecular formula C13H14F3NO5S and a molecular weight of 353.32 g/mol. Its IUPAC name is 4-[methyl(oxolan-3-yl)sulfamoyl]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[methyl(oxolan-3-yl)sulfamoyl]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 138001320 |
| Molecular Formula | C13H14F3NO5S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-[methyl(oxolan-3-yl)sulfamoyl]-2-(trifluoromethyl)benzoic acid |
| SMILES | CN(C1CCOC1)S(=O)(=O)c1ccc(C(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F3NO5S/c1-17(8-4-5-22-7-8)23(20,21)9-2-3-10(12(18)19)11(6-9)13(14,15)16/h2-3,6,8H,4-5,7H2,1H3,(H,18,19) |
| InChIKey | KQRAXGXMPAMPTP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |