C10H15N3O3S — CID 82743975
2-amino-N-methyl-N-(oxolan-3-yl)pyridine-4-sulfonamide (PubChem CID 82743975) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-amino-N-methyl-N-(oxolan-3-yl)pyridine-4-sulfonamide.
| Compound Name | 2-amino-N-methyl-N-(oxolan-3-yl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 82743975 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-amino-N-methyl-N-(oxolan-3-yl)pyridine-4-sulfonamide |
| SMILES | CN(C1CCOC1)S(=O)(=O)c1ccnc(N)c1 |
| InChI | InChI=1S/C10H15N3O3S/c1-13(8-3-5-16-7-8)17(14,15)9-2-4-12-10(11)6-9/h2,4,6,8H,3,5,7H2,1H3,(H2,11,12) |
| InChIKey | PYROVZUMFKLPOI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |