C10H14BrN3O3S — CID 113278224
2-amino-5-bromo-N-methyl-N-(oxolan-3-yl)pyridine-3-sulfonamide (PubChem CID 113278224) has the molecular formula C10H14BrN3O3S and a molecular weight of 336.21 g/mol. Its IUPAC name is 2-amino-5-bromo-N-methyl-N-(oxolan-3-yl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-bromo-N-methyl-N-(oxolan-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113278224 |
| Molecular Formula | C10H14BrN3O3S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 2-amino-5-bromo-N-methyl-N-(oxolan-3-yl)pyridine-3-sulfonamide |
| SMILES | CN(C1CCOC1)S(=O)(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C10H14BrN3O3S/c1-14(8-2-3-17-6-8)18(15,16)9-4-7(11)5-13-10(9)12/h4-5,8H,2-3,6H2,1H3,(H2,12,13) |
| InChIKey | JDXWLFXMSZCVTN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |