C12H16BrNO4S — CID 78947897
5-bromo-2-methoxy-N-methyl-N-(oxolan-3-yl)benzenesulfonamide (PubChem CID 78947897) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-methyl-N-(oxolan-3-yl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-methyl-N-(oxolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 78947897 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 5-bromo-2-methoxy-N-methyl-N-(oxolan-3-yl)benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)N(C)C1CCOC1 |
| InChI | InChI=1S/C12H16BrNO4S/c1-14(10-5-6-18-8-10)19(15,16)12-7-9(13)3-4-11(12)17-2/h3-4,7,10H,5-6,8H2,1-2H3 |
| InChIKey | KROIBFDEFPXNQS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |