C15H20N2O3S — CID 82729748
4-(3-aminoprop-1-ynyl)-N,3-dimethyl-N-(oxolan-3-yl)benzenesulfonamide (PubChem CID 82729748) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-N,3-dimethyl-N-(oxolan-3-yl)benzenesulfonamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-N,3-dimethyl-N-(oxolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 82729748 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-N,3-dimethyl-N-(oxolan-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C2CCOC2)ccc1C#CCN |
| InChI | InChI=1S/C15H20N2O3S/c1-12-10-15(6-5-13(12)4-3-8-16)21(18,19)17(2)14-7-9-20-11-14/h5-6,10,14H,7-9,11,16H2,1-2H3 |
| InChIKey | VURMTEJHRWWGMV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|