C10H13NO5S2 — CID 82733477
5-[methyl(oxolan-3-yl)sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 82733477) has the molecular formula C10H13NO5S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-[methyl(oxolan-3-yl)sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[methyl(oxolan-3-yl)sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 82733477 |
| Molecular Formula | C10H13NO5S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 5-[methyl(oxolan-3-yl)sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | CN(C1CCOC1)S(=O)(=O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C10H13NO5S2/c1-11(8-2-3-16-5-8)18(14,15)9-4-7(6-17-9)10(12)13/h4,6,8H,2-3,5H2,1H3,(H,12,13) |
| InChIKey | RNBZKLDMRHOLAP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |